C31H34FN3O2S — CID 18470459
5-[(1-benzyl-2-oxo-4-pyridinyl)methyl]-2-[8-(4-fluorophenyl)octylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 18470459) has the molecular formula C31H34FN3O2S and a molecular weight of 531.70 g/mol. Its IUPAC name is 5-[(1-benzyl-2-oxo-4-pyridinyl)methyl]-2-[8-(4-fluorophenyl)octylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[(1-benzyl-2-oxo-4-pyridinyl)methyl]-2-[8-(4-fluorophenyl)octylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 18470459 |
| Molecular Formula | C31H34FN3O2S |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 5-[(1-benzyl-2-oxo-4-pyridinyl)methyl]-2-[8-(4-fluorophenyl)octylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(SCCCCCCCCc2ccc(F)cc2)ncc1Cc1ccn(Cc2ccccc2)c(=O)c1 |
| InChI | InChI=1S/C31H34FN3O2S/c32-28-15-13-24(14-16-28)10-6-3-1-2-4-9-19-38-31-33-22-27(30(37)34-31)20-26-17-18-35(29(36)21-26)23-25-11-7-5-8-12-25/h5,7-8,11-18,21-22H,1-4,6,9-10,19-20,23H2,(H,33,34,37) |
| InChIKey | UAFNYCLNXKIGPC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|