C23H26ClN3O2S2 — CID 18470140
2-[7-(4-chlorophenyl)sulfinylheptylsulfanyl]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 18470140) has the molecular formula C23H26ClN3O2S2 and a molecular weight of 476.07 g/mol. Its IUPAC name is 2-[7-(4-chlorophenyl)sulfinylheptylsulfanyl]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[7-(4-chlorophenyl)sulfinylheptylsulfanyl]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 18470140 |
| Molecular Formula | C23H26ClN3O2S2 |
| Molecular Weight | 476.07 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[7-(4-chlorophenyl)sulfinylheptylsulfanyl]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(SCCCCCCCS(=O)c2ccc(Cl)cc2)ncc1Cc1cccnc1 |
| InChI | InChI=1S/C23H26ClN3O2S2/c24-20-8-10-21(11-9-20)31(29)14-5-3-1-2-4-13-30-23-26-17-19(22(28)27-23)15-18-7-6-12-25-16-18/h6-12,16-17H,1-5,13-15H2,(H,26,27,28) |
| InChIKey | BTKGBQMHXMXNLB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|