C18H13N3O — CID 123768984
5-(pyridin-3-ylmethyl)-8H-1,8-phenanthrolin-7-one (PubChem CID 123768984) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-(pyridin-3-ylmethyl)-8H-1,8-phenanthrolin-7-one.
| Compound Name | 5-(pyridin-3-ylmethyl)-8H-1,8-phenanthrolin-7-one |
|---|---|
| PubChem CID | 123768984 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-(pyridin-3-ylmethyl)-8H-1,8-phenanthrolin-7-one |
| SMILES | O=c1[nH]ccc2c1cc(Cc1cccnc1)c1cccnc12 |
| InChI | InChI=1S/C18H13N3O/c22-18-16-10-13(9-12-3-1-6-19-11-12)14-4-2-7-20-17(14)15(16)5-8-21-18/h1-8,10-11H,9H2,(H,21,22) |
| InChIKey | LXUGRKMHDNVDJW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|