About O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate
O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate (PubChem CID 54557615) has the molecular formula C19H24N2O2S2
and a molecular weight of 376.55 g/mol. Its IUPAC name is O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate.
Molecular Properties
| Compound Name | O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate |
| PubChem CID | 54557615 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate |
| SMILES | CCCCCCS(=O)c1ccc(NC(=S)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C19H24N2O2S2/c1-2-3-4-5-13-25(22)18-10-8-17(9-11-18)21-19(24)23-15-16-7-6-12-20-14-16/h6-12,14H,2-5,13,15H2,1H3,(H,21,24) |
| InChIKey | ZOGQFKVGVBMYSV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate?
The IUPAC name of O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate (CID 54557615) is O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate.
What is the SMILES notation for O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate?
The canonical SMILES for O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate is CCCCCCS(=O)c1ccc(NC(=S)OCc2cccnc2)cc1.
What is the InChIKey of O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate?
The InChIKey is ZOGQFKVGVBMYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O2S2/c1-2-3-4-5-13-25(22)18-10-8-17(9-11-18)21-19(24)23-15-16-7-6-12-20-14-16/h6-12,14H,2-5,13,15H2,1H3,(H,21,24).
What are the key properties of O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate?
O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate has a molecular weight of 376.55 g/mol, XLogP of 4.68, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(pyridin-3-ylmethyl) N-(4-hexylsulfinylphenyl)carbamothioate is sourced from PubChem (CID 54557615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).