C14H14N2O2S2 — CID 54039406
O-(pyridin-3-ylmethyl) N-(4-methylsulfinylphenyl)carbamothioate (PubChem CID 54039406) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is O-(pyridin-3-ylmethyl) N-(4-methylsulfinylphenyl)carbamothioate.
| Compound Name | O-(pyridin-3-ylmethyl) N-(4-methylsulfinylphenyl)carbamothioate |
|---|---|
| PubChem CID | 54039406 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | O-(pyridin-3-ylmethyl) N-(4-methylsulfinylphenyl)carbamothioate |
| SMILES | CS(=O)c1ccc(NC(=S)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C14H14N2O2S2/c1-20(17)13-6-4-12(5-7-13)16-14(19)18-10-11-3-2-8-15-9-11/h2-9H,10H2,1H3,(H,16,19) |
| InChIKey | LLGYEKJWXZNAQU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|