C22H34O6 — CID 18471234
2,2-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl]hexanedioic acid (PubChem CID 18471234) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2,2-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl]hexanedioic acid.
| Compound Name | 2,2-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 18471234 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2,2-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl]hexanedioic acid |
| SMILES | CC1CC2OC2CC1CC(CCCC(=O)O)(CC1CC2OC2CC1C)C(=O)O |
| InChI | InChI=1S/C22H34O6/c1-12-6-16-18(27-16)8-14(12)10-22(21(25)26,5-3-4-20(23)24)11-15-9-19-17(28-19)7-13(15)2/h12-19H,3-11H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | DWHQMNXGOKGGRN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|