About 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid
6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid (PubChem CID 87874183) has the molecular formula C19H28O6
and a molecular weight of 352.43 g/mol. Its IUPAC name is 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid.
Molecular Properties
| Compound Name | 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid |
| PubChem CID | 87874183 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid |
| SMILES | COC(=O)C(CCCC(=O)O)(C1CCC2OC2C1)C1CCC2OC2C1 |
| InChI | InChI=1S/C19H28O6/c1-23-18(22)19(8-2-3-17(20)21,11-4-6-13-15(9-11)24-13)12-5-7-14-16(10-12)25-14/h11-16H,2-10H2,1H3,(H,20,21) |
| InChIKey | YDJVDBJIONONST-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid?
The IUPAC name of 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid (CID 87874183) is 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid.
What is the SMILES notation for 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid?
The canonical SMILES for 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid is COC(=O)C(CCCC(=O)O)(C1CCC2OC2C1)C1CCC2OC2C1.
What is the InChIKey of 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid?
The InChIKey is YDJVDBJIONONST-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O6/c1-23-18(22)19(8-2-3-17(20)21,11-4-6-13-15(9-11)24-13)12-5-7-14-16(10-12)25-14/h11-16H,2-10H2,1H3,(H,20,21).
What are the key properties of 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid?
6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid has a molecular weight of 352.43 g/mol, XLogP of 2.54, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-5,5-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-6-oxohexanoic acid is sourced from PubChem (CID 87874183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).