C15H24O5 — CID 134903408
methyl 6-[(3aR,4S,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2,2-dimethyl-6-oxohexanoate (PubChem CID 134903408) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is methyl 6-[(3aR,4S,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2,2-dimethyl-6-oxohexanoate.
| Compound Name | methyl 6-[(3aR,4S,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2,2-dimethyl-6-oxohexanoate |
|---|---|
| PubChem CID | 134903408 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl 6-[(3aR,4S,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2,2-dimethyl-6-oxohexanoate |
| SMILES | COC(=O)C(C)(C)CCCC(=O)[C@H]1CC[C@@H]2OCO[C@@H]21 |
| InChI | InChI=1S/C15H24O5/c1-15(2,14(17)18-3)8-4-5-11(16)10-6-7-12-13(10)20-9-19-12/h10,12-13H,4-9H2,1-3H3/t10-,12+,13-/m1/s1 |
| InChIKey | LESTWHAUZPFBNJ-KGYLQXTDSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |