C16H10F6N2O3 — CID 18471660
2-(carbamoylamino)-4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 18471660) has the molecular formula C16H10F6N2O3 and a molecular weight of 392.26 g/mol. Its IUPAC name is 2-(carbamoylamino)-4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 2-(carbamoylamino)-4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 18471660 |
| Molecular Formula | C16H10F6N2O3 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-(carbamoylamino)-4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | NC(=O)Nc1cc(C(F)(F)F)cc(-c2ccccc2C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C16H10F6N2O3/c17-15(18,19)7-5-9(8-3-1-2-4-10(8)16(20,21)22)12(13(25)26)11(6-7)24-14(23)27/h1-6H,(H,25,26)(H3,23,24,27) |
| InChIKey | RFSQYZINDNYCDE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |