C19H15FN2O2 — CID 18474516
4-[(Z)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid (PubChem CID 18474516) has the molecular formula C19H15FN2O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-[(Z)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid.
| Compound Name | 4-[(Z)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 18474516 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-[(Z)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=C(\Cn2ccnc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H15FN2O2/c20-18-7-5-15(6-8-18)17(12-22-10-9-21-13-22)11-14-1-3-16(4-2-14)19(23)24/h1-11,13H,12H2,(H,23,24)/b17-11+ |
| InChIKey | ZBAWVGXKUNVCSX-GZTJUZNOSA-N |
| XLogP | 3.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|