C28H23F2N3O3 — CID 70168870
(2S)-2-[[2-(4-fluorophenyl)-4-[(E)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoyl]amino]propanoic acid (PubChem CID 70168870) has the molecular formula C28H23F2N3O3 and a molecular weight of 487.51 g/mol. Its IUPAC name is (2S)-2-[[2-(4-fluorophenyl)-4-[(E)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(4-fluorophenyl)-4-[(E)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70168870 |
| Molecular Formula | C28H23F2N3O3 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (2S)-2-[[2-(4-fluorophenyl)-4-[(E)-2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc(/C=C(/Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C28H23F2N3O3/c1-18(28(35)36)32-27(34)25-11-2-19(15-26(25)21-5-9-24(30)10-6-21)14-22(16-33-13-12-31-17-33)20-3-7-23(29)8-4-20/h2-15,17-18H,16H2,1H3,(H,32,34)(H,35,36)/b22-14-/t18-/m0/s1 |
| InChIKey | XSBLPOGHQXRNCG-GFHXCNCHSA-N |
| XLogP | 5.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|