C25H18F2N2O2 — CID 54273924
2-(4-fluorophenyl)-4-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid (PubChem CID 54273924) has the molecular formula C25H18F2N2O2 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid.
| Compound Name | 2-(4-fluorophenyl)-4-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54273924 |
| Molecular Formula | C25H18F2N2O2 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H18F2N2O2/c26-21-6-2-18(3-7-21)20(15-29-12-11-28-16-29)13-17-1-10-23(25(30)31)24(14-17)19-4-8-22(27)9-5-19/h1-14,16H,15H2,(H,30,31) |
| InChIKey | RMBRFYMJCYNPQE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|