C35H42N6O2 — CID 18475898
N-[2-(3-carbamimidoylphenyl)-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3-oxoquinoxalin-6-yl]-2-phenylacetamide (PubChem CID 18475898) has the molecular formula C35H42N6O2 and a molecular weight of 578.76 g/mol. Its IUPAC name is N-[2-(3-carbamimidoylphenyl)-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3-oxoquinoxalin-6-yl]-2-phenylacetamide.
| Compound Name | N-[2-(3-carbamimidoylphenyl)-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3-oxoquinoxalin-6-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 18475898 |
| Molecular Formula | C35H42N6O2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | N-[2-(3-carbamimidoylphenyl)-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3-oxoquinoxalin-6-yl]-2-phenylacetamide |
| SMILES | [H]/N=C(\N)c1cccc(-c2nc3ccc(NC(=O)Cc4ccccc4)cc3n(CCCCCN3C(C)CCCC3C)c2=O)c1 |
| InChI | InChI=1S/C35H42N6O2/c1-24-11-9-12-25(2)40(24)19-7-4-8-20-41-31-23-29(38-32(42)21-26-13-5-3-6-14-26)17-18-30(31)39-33(35(41)43)27-15-10-16-28(22-27)34(36)37/h3,5-6,10,13-18,22-25H,4,7-9,11-12,19-21H2,1-2H3,(H3,36,37)(H,38,42) |
| InChIKey | IPESDGSXLWZPDI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|