C15H24O6Si — CID 18477240
1-tris(prop-1-en-2-yloxy)silyloxypropyl prop-2-enoate (PubChem CID 18477240) has the molecular formula C15H24O6Si and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-tris(prop-1-en-2-yloxy)silyloxypropyl prop-2-enoate.
| Compound Name | 1-tris(prop-1-en-2-yloxy)silyloxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 18477240 |
| Molecular Formula | C15H24O6Si |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-tris(prop-1-en-2-yloxy)silyloxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)O[Si](OC(=C)C)(OC(=C)C)OC(=C)C |
| InChI | InChI=1S/C15H24O6Si/c1-9-14(16)17-15(10-2)21-22(18-11(3)4,19-12(5)6)20-13(7)8/h9,15H,1,3,5,7,10H2,2,4,6,8H3 |
| InChIKey | IHVVRUKSMFOXEF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|