C21H31N5O8 — CID 18492056
2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18492056) has the molecular formula C21H31N5O8 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18492056 |
| Molecular Formula | C21H31N5O8 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)CN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H31N5O8/c22-8-2-1-3-14(19(31)26-16(21(33)34)10-18(29)30)25-20(32)15(24-17(28)11-23)9-12-4-6-13(27)7-5-12/h4-7,14-16,27H,1-3,8-11,22-23H2,(H,24,28)(H,25,32)(H,26,31)(H,29,30)(H,33,34) |
| InChIKey | YMHGPQRXJUJUAV-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|