C23H22F3N3O2 — CID 18504898
1-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]indole-5-carboxamide (PubChem CID 18504898) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 1-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]indole-5-carboxamide.
| Compound Name | 1-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]indole-5-carboxamide |
|---|---|
| PubChem CID | 18504898 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]indole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(ccn2N2CCC(Cc3ccccc3)C(C(=O)C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C23H22F3N3O2/c24-23(25,26)21(30)19-14-28(10-8-16(19)12-15-4-2-1-3-5-15)29-11-9-17-13-18(22(27)31)6-7-20(17)29/h1-7,9,11,13,16,19H,8,10,12,14H2,(H2,27,31) |
| InChIKey | FVHPZTBVZSWSIE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |