C14H17F3N2O2 — CID 18509746
[2-[2-amino-4-(trifluoromethyl)anilino]cyclopentyl] acetate (PubChem CID 18509746) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is [2-[2-amino-4-(trifluoromethyl)anilino]cyclopentyl] acetate.
| Compound Name | [2-[2-amino-4-(trifluoromethyl)anilino]cyclopentyl] acetate |
|---|---|
| PubChem CID | 18509746 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [2-[2-amino-4-(trifluoromethyl)anilino]cyclopentyl] acetate |
| SMILES | CC(=O)OC1CCCC1Nc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C14H17F3N2O2/c1-8(20)21-13-4-2-3-12(13)19-11-6-5-9(7-10(11)18)14(15,16)17/h5-7,12-13,19H,2-4,18H2,1H3 |
| InChIKey | UFDUTWMMEQKFGP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|