C22H22Br2N2O3S — CID 18512101
N-[3-[bis[(2-bromophenyl)methyl]amino]-4-methoxyphenyl]methanesulfonamide (PubChem CID 18512101) has the molecular formula C22H22Br2N2O3S and a molecular weight of 554.30 g/mol. Its IUPAC name is N-[3-[bis[(2-bromophenyl)methyl]amino]-4-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[3-[bis[(2-bromophenyl)methyl]amino]-4-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18512101 |
| Molecular Formula | C22H22Br2N2O3S |
| Molecular Weight | 554.30 g/mol |
| Exact Mass | 551.97 |
| IUPAC Name | N-[3-[bis[(2-bromophenyl)methyl]amino]-4-methoxyphenyl]methanesulfonamide |
| SMILES | COc1ccc(NS(C)(=O)=O)cc1N(Cc1ccccc1Br)Cc1ccccc1Br |
| InChI | InChI=1S/C22H22Br2N2O3S/c1-29-22-12-11-18(25-30(2,27)28)13-21(22)26(14-16-7-3-5-9-19(16)23)15-17-8-4-6-10-20(17)24/h3-13,25H,14-15H2,1-2H3 |
| InChIKey | MNUPXPCEWBQHNV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |