C21H22ClN2O4S+ — CID 18516241
[4-(4-chlorophenoxy)-2-(methylcarbamoyl)thieno[2,3-c]pyridin-6-ium-6-yl]methyl 2,2-dimethylpropanoate (PubChem CID 18516241) has the molecular formula C21H22ClN2O4S+ and a molecular weight of 433.94 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)-2-(methylcarbamoyl)thieno[2,3-c]pyridin-6-ium-6-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-(4-chlorophenoxy)-2-(methylcarbamoyl)thieno[2,3-c]pyridin-6-ium-6-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18516241 |
| Molecular Formula | C21H22ClN2O4S+ |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [4-(4-chlorophenoxy)-2-(methylcarbamoyl)thieno[2,3-c]pyridin-6-ium-6-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CNC(=O)c1cc2c(Oc3ccc(Cl)cc3)c[n+](COC(=O)C(C)(C)C)cc2s1 |
| InChI | InChI=1S/C21H21ClN2O4S/c1-21(2,3)20(26)27-12-24-10-16(28-14-7-5-13(22)6-8-14)15-9-17(19(25)23-4)29-18(15)11-24/h5-11H,12H2,1-4H3/p+1 |
| InChIKey | FEQAXYJLPXEOFM-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|