C17H28O8P2 — CID 18519035
3-[3,4-bis(diethoxyphosphoryl)phenyl]propanoic acid (PubChem CID 18519035) has the molecular formula C17H28O8P2 and a molecular weight of 422.35 g/mol. Its IUPAC name is 3-[3,4-bis(diethoxyphosphoryl)phenyl]propanoic acid.
| Compound Name | 3-[3,4-bis(diethoxyphosphoryl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 18519035 |
| Molecular Formula | C17H28O8P2 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3-[3,4-bis(diethoxyphosphoryl)phenyl]propanoic acid |
| SMILES | CCOP(=O)(OCC)c1ccc(CCC(=O)O)cc1P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H28O8P2/c1-5-22-26(20,23-6-2)15-11-9-14(10-12-17(18)19)13-16(15)27(21,24-7-3)25-8-4/h9,11,13H,5-8,10,12H2,1-4H3,(H,18,19) |
| InChIKey | TWHDMOASZWUGTG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|