C19H32O8P2 — CID 54425306
methyl 3-[3-diethoxyphosphoryl-4-(diethoxyphosphorylmethyl)phenyl]propanoate (PubChem CID 54425306) has the molecular formula C19H32O8P2 and a molecular weight of 450.41 g/mol. Its IUPAC name is methyl 3-[3-diethoxyphosphoryl-4-(diethoxyphosphorylmethyl)phenyl]propanoate.
| Compound Name | methyl 3-[3-diethoxyphosphoryl-4-(diethoxyphosphorylmethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 54425306 |
| Molecular Formula | C19H32O8P2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | methyl 3-[3-diethoxyphosphoryl-4-(diethoxyphosphorylmethyl)phenyl]propanoate |
| SMILES | CCOP(=O)(Cc1ccc(CCC(=O)OC)cc1P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C19H32O8P2/c1-6-24-28(21,25-7-2)15-17-12-10-16(11-13-19(20)23-5)14-18(17)29(22,26-8-3)27-9-4/h10,12,14H,6-9,11,13,15H2,1-5H3 |
| InChIKey | WDRBEWAJIDFEPV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|