C21H36F3NO11P2S — CID 157057293
tert-butyl N-[[3,4-bis(diethoxyphosphoryl)phenyl]methyl]carbamate;trifluoromethanesulfonic acid (PubChem CID 157057293) has the molecular formula C21H36F3NO11P2S and a molecular weight of 629.52 g/mol. Its IUPAC name is tert-butyl N-[[3,4-bis(diethoxyphosphoryl)phenyl]methyl]carbamate;trifluoromethanesulfonic acid.
| Compound Name | tert-butyl N-[[3,4-bis(diethoxyphosphoryl)phenyl]methyl]carbamate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 157057293 |
| Molecular Formula | C21H36F3NO11P2S |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | tert-butyl N-[[3,4-bis(diethoxyphosphoryl)phenyl]methyl]carbamate;trifluoromethanesulfonic acid |
| SMILES | CCOP(=O)(OCC)c1ccc(CNC(=O)OC(C)(C)C)cc1P(=O)(OCC)OCC.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C20H35NO8P2.CHF3O3S/c1-8-25-30(23,26-9-2)17-13-12-16(15-21-19(22)29-20(5,6)7)14-18(17)31(24,27-10-3)28-11-4;2-1(3,4)8(5,6)7/h12-14H,8-11,15H2,1-7H3,(H,21,22);(H,5,6,7) |
| InChIKey | AAXGWHZWAABGHU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|