C18H27INO3PS — CID 170613404
tert-butyl N-[[3-dimethylphosphoryl-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate;ethane (PubChem CID 170613404) has the molecular formula C18H27INO3PS and a molecular weight of 495.36 g/mol. Its IUPAC name is tert-butyl N-[[3-dimethylphosphoryl-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[3-dimethylphosphoryl-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 170613404 |
| Molecular Formula | C18H27INO3PS |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | tert-butyl N-[[3-dimethylphosphoryl-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCc1ccc(C#CSI)c(P(C)(C)=O)c1 |
| InChI | InChI=1S/C16H21INO3PS.C2H6/c1-16(2,3)21-15(19)18-11-12-6-7-13(8-9-23-17)14(10-12)22(4,5)20;1-2/h6-7,10H,11H2,1-5H3,(H,18,19);1-2H3 |
| InChIKey | QDGDTLQNHOFWFT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|