C14H16INO3S — CID 166459565
tert-butyl N-[[2-hydroxy-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate (PubChem CID 166459565) has the molecular formula C14H16INO3S and a molecular weight of 405.26 g/mol. Its IUPAC name is tert-butyl N-[[2-hydroxy-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-hydroxy-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166459565 |
| Molecular Formula | C14H16INO3S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | tert-butyl N-[[2-hydroxy-4-(2-iodosulfanylethynyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C#CSI)cc1O |
| InChI | InChI=1S/C14H16INO3S/c1-14(2,3)19-13(18)16-9-11-5-4-10(6-7-20-15)8-12(11)17/h4-5,8,17H,9H2,1-3H3,(H,16,18) |
| InChIKey | TULUSKRBSVGWDZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|