2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride

C17H28ClNO4 — CID 18526676

IUPAC2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride
SMILESCCCOc1ccc(C(=O)OCC[NH+](C)C)cc1OCCC.[Cl-]
InChIInChI=1S/C17H27NO4.ClH/c1-5-10-20-15-8-7-14(13-16(15)21-11-6-2)17(19)22-12-9-18(3)4;/h7-8,13H,5-6,9-12H2,1-4H3;1H
InChIKeyCPOKELPGHXJUHV-UHFFFAOYSA-N
MW345.87 g/mol
LogP-1.43
Rot. Bonds10

About 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride

2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride (PubChem CID 18526676) has the molecular formula C17H28ClNO4 and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride.

Molecular Properties

Compound Name2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride
PubChem CID18526676
Molecular FormulaC17H28ClNO4
Molecular Weight345.87 g/mol
Exact Mass345.17
IUPAC Name2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride
SMILESCCCOc1ccc(C(=O)OCC[NH+](C)C)cc1OCCC.[Cl-]
InChIInChI=1S/C17H27NO4.ClH/c1-5-10-20-15-8-7-14(13-16(15)21-11-6-2)17(19)22-12-9-18(3)4;/h7-8,13H,5-6,9-12H2,1-4H3;1H
InChIKeyCPOKELPGHXJUHV-UHFFFAOYSA-N
XLogP-1.43
TPSA49.20 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.87
LogP ≤ 5-1.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride?
The IUPAC name of 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride (CID 18526676) is 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride.
What is the SMILES notation for 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride?
The canonical SMILES for 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride is CCCOc1ccc(C(=O)OCC[NH+](C)C)cc1OCCC.[Cl-].
What is the InChIKey of 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride?
The InChIKey is CPOKELPGHXJUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO4.ClH/c1-5-10-20-15-8-7-14(13-16(15)21-11-6-2)17(19)22-12-9-18(3)4;/h7-8,13H,5-6,9-12H2,1-4H3;1H.
What are the key properties of 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride?
2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride has a molecular weight of 345.87 g/mol, XLogP of -1.43, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dipropoxybenzoyl)oxyethyl-dimethylazanium chloride is sourced from PubChem (CID 18526676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).