C11H14IN3O2S — CID 18527409
1-[5-amino-2-(4-methoxyphenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone;hydroiodide (PubChem CID 18527409) has the molecular formula C11H14IN3O2S and a molecular weight of 379.22 g/mol. Its IUPAC name is 1-[5-amino-2-(4-methoxyphenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone;hydroiodide.
| Compound Name | 1-[5-amino-2-(4-methoxyphenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone;hydroiodide |
|---|---|
| PubChem CID | 18527409 |
| Molecular Formula | C11H14IN3O2S |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 1-[5-amino-2-(4-methoxyphenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone;hydroiodide |
| SMILES | COc1ccc(C2SC(N)=NN2C(C)=O)cc1.I |
| InChI | InChI=1S/C11H13N3O2S.HI/c1-7(15)14-10(17-11(12)13-14)8-3-5-9(16-2)6-4-8;/h3-6,10H,1-2H3,(H2,12,13);1H |
| InChIKey | DVASFXBSEAHXMF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|