C37H22BrCl2N5O2 — CID 18531318
3-[(Z)-2-(5-bromo-2-phenylmethoxyphenyl)-1-cyanoethenyl]-5-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-phenylpyrazole-4-carbonitrile (PubChem CID 18531318) has the molecular formula C37H22BrCl2N5O2 and a molecular weight of 719.43 g/mol. Its IUPAC name is 3-[(Z)-2-(5-bromo-2-phenylmethoxyphenyl)-1-cyanoethenyl]-5-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 3-[(Z)-2-(5-bromo-2-phenylmethoxyphenyl)-1-cyanoethenyl]-5-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 18531318 |
| Molecular Formula | C37H22BrCl2N5O2 |
| Molecular Weight | 719.43 g/mol |
| Exact Mass | 717.03 |
| IUPAC Name | 3-[(Z)-2-(5-bromo-2-phenylmethoxyphenyl)-1-cyanoethenyl]-5-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#C/C(=C\c1cc(Br)ccc1OCc1ccccc1)c1nn(-c2ccccc2)c(/N=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)c1C#N |
| InChI | InChI=1S/C37H22BrCl2N5O2/c38-27-11-15-34(46-23-24-7-3-1-4-8-24)25(18-27)17-26(20-41)36-32(21-42)37(45(44-36)29-9-5-2-6-10-29)43-22-30-13-16-35(47-30)31-14-12-28(39)19-33(31)40/h1-19,22H,23H2/b26-17+,43-22+ |
| InChIKey | UDERPQWBRUBSRP-NKWSKDDXSA-N |
| XLogP | 10.47 |
| TPSA | 100.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.43 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|