C16H10ClF3N2O2 — CID 18531940
4-(4-chlorobenzoyl)-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 18531940) has the molecular formula C16H10ClF3N2O2 and a molecular weight of 354.72 g/mol. Its IUPAC name is 4-(4-chlorobenzoyl)-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(4-chlorobenzoyl)-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 18531940 |
| Molecular Formula | C16H10ClF3N2O2 |
| Molecular Weight | 354.72 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-(4-chlorobenzoyl)-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)c2ccc(Cl)cc2)c2ccc(C(F)(F)F)cc2N1 |
| InChI | InChI=1S/C16H10ClF3N2O2/c17-11-4-1-9(2-5-11)15(24)22-8-14(23)21-12-7-10(16(18,19)20)3-6-13(12)22/h1-7H,8H2,(H,21,23) |
| InChIKey | MHGOLXDOPKWDMM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |