C28H33N3O2+2 — CID 18532850
(1R,2R,6S,7S)-4-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 18532850) has the molecular formula C28H33N3O2+2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-4-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 18532850 |
| Molecular Formula | C28H33N3O2+2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (1R,2R,6S,7S)-4-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=C[C@H]2C[C@H]1[C@@H]1C(=O)N(C[NH+]3CC[NH+](C(c4ccccc4)c4ccccc4)CC3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H31N3O2/c1-19-16-22-17-23(19)25-24(22)27(32)31(28(25)33)18-29-12-14-30(15-13-29)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,16,22-26H,12-15,17-18H2,1H3/p+2/t22-,23+,24+,25-/m0/s1 |
| InChIKey | CLZOAZSQIINCJH-LIONHTAISA-P |
| XLogP | 0.71 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|