C19H25NO3 — CID 18532863
(3S)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 18532863) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (3S)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 18532863 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (3S)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](NC(=O)[C@@H]1COc3ccccc3O1)C2 |
| InChI | InChI=1S/C19H25NO3/c1-18(2)12-8-9-19(18,3)16(10-12)20-17(21)15-11-22-13-6-4-5-7-14(13)23-15/h4-7,12,15-16H,8-11H2,1-3H3,(H,20,21)/t12-,15-,16-,19-/m0/s1 |
| InChIKey | LWLPORXSTYOEKY-DLLGKBFGSA-N |
| XLogP | 3.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |