C13H11N3S4 — CID 18536775
5-methylsulfanyl-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-carboximidamide (PubChem CID 18536775) has the molecular formula C13H11N3S4 and a molecular weight of 337.52 g/mol. Its IUPAC name is 5-methylsulfanyl-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-carboximidamide.
| Compound Name | 5-methylsulfanyl-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18536775 |
| Molecular Formula | C13H11N3S4 |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 5-methylsulfanyl-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccs3)cs2)c(SC)s1 |
| InChI | InChI=1S/C13H11N3S4/c1-17-13-7(5-10(20-13)11(14)15)12-16-8(6-19-12)9-3-2-4-18-9/h2-6H,1H3,(H3,14,15) |
| InChIKey | PYBQUZRFYXFVJH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|