C16H15N3S3 — CID 18537029
4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide (PubChem CID 18537029) has the molecular formula C16H15N3S3 and a molecular weight of 345.52 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide.
| Compound Name | 4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18537029 |
| Molecular Formula | C16H15N3S3 |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(C)c3)cs2)c(SC)s1 |
| InChI | InChI=1S/C16H15N3S3/c1-9-4-3-5-10(6-9)12-8-21-15(19-12)11-7-13(14(17)18)22-16(11)20-2/h3-8H,1-2H3,(H3,17,18) |
| InChIKey | MEKFQRDWXPJRHC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|