C20H23N5O2S4 — CID 18537172
5-methylsulfanyl-4-[2-(4-piperidin-1-ylsulfonylanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide (PubChem CID 18537172) has the molecular formula C20H23N5O2S4 and a molecular weight of 493.71 g/mol. Its IUPAC name is 5-methylsulfanyl-4-[2-(4-piperidin-1-ylsulfonylanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide.
| Compound Name | 5-methylsulfanyl-4-[2-(4-piperidin-1-ylsulfonylanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18537172 |
| Molecular Formula | C20H23N5O2S4 |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 5-methylsulfanyl-4-[2-(4-piperidin-1-ylsulfonylanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2csc(Nc3ccc(S(=O)(=O)N4CCCCC4)cc3)n2)c(SC)s1 |
| InChI | InChI=1S/C20H23N5O2S4/c1-28-19-15(11-17(30-19)18(21)22)16-12-29-20(24-16)23-13-5-7-14(8-6-13)31(26,27)25-9-3-2-4-10-25/h5-8,11-12H,2-4,9-10H2,1H3,(H3,21,22)(H,23,24) |
| InChIKey | ZCTRSENMOSCAEH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|