C15H12FN3O2S2 — CID 973022
4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide (PubChem CID 973022) has the molecular formula C15H12FN3O2S2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 973022 |
| Molecular Formula | C15H12FN3O2S2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C15H12FN3O2S2/c16-11-3-1-10(2-4-11)14-9-22-15(19-14)18-12-5-7-13(8-6-12)23(17,20)21/h1-9H,(H,18,19)(H2,17,20,21) |
| InChIKey | UITMFWHKWOCVFI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |