C28H32N8O5 — CID 18537772
2-(2-ethoxycarbonylphenoxy)ethyl 2-[1-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 18537772) has the molecular formula C28H32N8O5 and a molecular weight of 560.62 g/mol. Its IUPAC name is 2-(2-ethoxycarbonylphenoxy)ethyl 2-[1-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate.
| Compound Name | 2-(2-ethoxycarbonylphenoxy)ethyl 2-[1-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 18537772 |
| Molecular Formula | C28H32N8O5 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 2-(2-ethoxycarbonylphenoxy)ethyl 2-[1-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1ccccc1OCCOC(=O)N1CCc2nc(C(C)c3nc4ccc(N=C(N)N)cc4[nH]3)[nH]c2C1 |
| InChI | InChI=1S/C28H32N8O5/c1-3-39-26(37)18-6-4-5-7-23(18)40-12-13-41-28(38)36-11-10-20-22(15-36)35-25(33-20)16(2)24-32-19-9-8-17(31-27(29)30)14-21(19)34-24/h4-9,14,16H,3,10-13,15H2,1-2H3,(H,32,34)(H,33,35)(H4,29,30,31) |
| InChIKey | NOATXBJOKHAECC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 186.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|