C21H23FN4O2 — CID 18540173
3-[2-fluoro-4-(3-piperazin-1-ylpropoxy)phenyl]-5-phenyl-1,2,4-oxadiazole (PubChem CID 18540173) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-[2-fluoro-4-(3-piperazin-1-ylpropoxy)phenyl]-5-phenyl-1,2,4-oxadiazole.
| Compound Name | 3-[2-fluoro-4-(3-piperazin-1-ylpropoxy)phenyl]-5-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 18540173 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[2-fluoro-4-(3-piperazin-1-ylpropoxy)phenyl]-5-phenyl-1,2,4-oxadiazole |
| SMILES | Fc1cc(OCCCN2CCNCC2)ccc1-c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H23FN4O2/c22-19-15-17(27-14-4-11-26-12-9-23-10-13-26)7-8-18(19)20-24-21(28-25-20)16-5-2-1-3-6-16/h1-3,5-8,15,23H,4,9-14H2 |
| InChIKey | ZANOXYOQLSRRBN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|