C50H56O4P2 — CID 18544210
butanedioate;bis(ethyl-tris(4-methylphenyl)phosphanium) (PubChem CID 18544210) has the molecular formula C50H56O4P2 and a molecular weight of 782.94 g/mol. Its IUPAC name is butanedioate;bis(ethyl-tris(4-methylphenyl)phosphanium).
| Compound Name | butanedioate;bis(ethyl-tris(4-methylphenyl)phosphanium) |
|---|---|
| PubChem CID | 18544210 |
| Molecular Formula | C50H56O4P2 |
| Molecular Weight | 782.94 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | butanedioate;bis(ethyl-tris(4-methylphenyl)phosphanium) |
| SMILES | CC[P+](c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1.CC[P+](c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1.O=C([O-])CCC(=O)[O-] |
| InChI | InChI=1S/2C23H26P.C4H6O4/c2*1-5-24(21-12-6-18(2)7-13-21,22-14-8-19(3)9-15-22)23-16-10-20(4)11-17-23;5-3(6)1-2-4(7)8/h2*6-17H,5H2,1-4H3;1-2H2,(H,5,6)(H,7,8)/q2*+1;/p-2 |
| InChIKey | VSHXJQWRZCDJTN-UHFFFAOYSA-L |
| XLogP | 7.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.94 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|