C21H30N4O7S — CID 18545095
2-N-hydroxy-3-N-[1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-oxohexan-3-yl]oxirane-2,3-dicarboxamide (PubChem CID 18545095) has the molecular formula C21H30N4O7S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-N-hydroxy-3-N-[1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-oxohexan-3-yl]oxirane-2,3-dicarboxamide.
| Compound Name | 2-N-hydroxy-3-N-[1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-oxohexan-3-yl]oxirane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 18545095 |
| Molecular Formula | C21H30N4O7S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-N-hydroxy-3-N-[1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-oxohexan-3-yl]oxirane-2,3-dicarboxamide |
| SMILES | CCCC(CC(=O)N1CCN(S(=O)(=O)c2ccc(C)cc2)CC1)NC(=O)C1OC1C(=O)NO |
| InChI | InChI=1S/C21H30N4O7S/c1-3-4-15(22-20(27)18-19(32-18)21(28)23-29)13-17(26)24-9-11-25(12-10-24)33(30,31)16-7-5-14(2)6-8-16/h5-8,15,18-19,29H,3-4,9-13H2,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | HZZOREKIWXWAHO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|