About butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium
butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium (PubChem CID 18547577) has the molecular formula C18H36O4S2
and a molecular weight of 380.62 g/mol. Its IUPAC name is butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium.
Molecular Properties
| Compound Name | butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium |
| PubChem CID | 18547577 |
| Molecular Formula | C18H36O4S2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium |
| SMILES | CC(C)[S+](CC(=O)C1CCCCC1)C(C)C.CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C14H27OS.C4H10O3S/c1-11(2)16(12(3)4)10-14(15)13-8-6-5-7-9-13;1-2-3-4-8(5,6)7/h11-13H,5-10H2,1-4H3;2-4H2,1H3,(H,5,6,7)/q+1;/p-1 |
| InChIKey | GXBMWANDEOGGCN-UHFFFAOYSA-M |
| XLogP | 3.90 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium?
The IUPAC name of butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium (CID 18547577) is butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium.
What is the SMILES notation for butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium?
The canonical SMILES for butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium is CC(C)[S+](CC(=O)C1CCCCC1)C(C)C.CCCCS(=O)(=O)[O-].
What is the InChIKey of butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium?
The InChIKey is GXBMWANDEOGGCN-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H27OS.C4H10O3S/c1-11(2)16(12(3)4)10-14(15)13-8-6-5-7-9-13;1-2-3-4-8(5,6)7/h11-13H,5-10H2,1-4H3;2-4H2,1H3,(H,5,6,7)/q+1;/p-1.
What are the key properties of butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium?
butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium has a molecular weight of 380.62 g/mol, XLogP of 3.90, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-sulfonate;(2-cyclohexyl-2-oxoethyl)-di(propan-2-yl)sulfanium is sourced from PubChem (CID 18547577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).