C21H34O4S2 — CID 18547611
cyclohexyl-methyl-(2-oxoheptyl)sulfanium;4-methylbenzenesulfonate (PubChem CID 18547611) has the molecular formula C21H34O4S2 and a molecular weight of 414.63 g/mol. Its IUPAC name is cyclohexyl-methyl-(2-oxoheptyl)sulfanium;4-methylbenzenesulfonate.
| Compound Name | cyclohexyl-methyl-(2-oxoheptyl)sulfanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 18547611 |
| Molecular Formula | C21H34O4S2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | cyclohexyl-methyl-(2-oxoheptyl)sulfanium;4-methylbenzenesulfonate |
| SMILES | CCCCCC(=O)C[S+](C)C1CCCCC1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H27OS.C7H8O3S/c1-3-4-6-9-13(15)12-16(2)14-10-7-5-8-11-14;1-6-2-4-7(5-3-6)11(8,9)10/h14H,3-12H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | HSCHIZXXXQMONY-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|