C12H23F3O4S2 — CID 18547830
tert-butyl-(3,3-dimethyl-2-oxobutyl)-methylsulfanium;trifluoromethanesulfonate (PubChem CID 18547830) has the molecular formula C12H23F3O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is tert-butyl-(3,3-dimethyl-2-oxobutyl)-methylsulfanium;trifluoromethanesulfonate.
| Compound Name | tert-butyl-(3,3-dimethyl-2-oxobutyl)-methylsulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18547830 |
| Molecular Formula | C12H23F3O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | tert-butyl-(3,3-dimethyl-2-oxobutyl)-methylsulfanium;trifluoromethanesulfonate |
| SMILES | C[S+](CC(=O)C(C)(C)C)C(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H23OS.CHF3O3S/c1-10(2,3)9(12)8-13(7)11(4,5)6;2-1(3,4)8(5,6)7/h8H2,1-7H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | NENCPEXWPPLMGT-UHFFFAOYSA-M |
| XLogP | 2.70 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|