5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid

C13H9NO6 — CID 18548731

IUPAC5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)CC(=O)c1cccc(-c2ocnc2C(=O)O)c1
InChIInChI=1S/C13H9NO6/c15-9(5-10(16)17)7-2-1-3-8(4-7)12-11(13(18)19)14-6-20-12/h1-4,6H,5H2,(H,16,17)(H,18,19)
InChIKeyDYIXTNBDZKXEKA-UHFFFAOYSA-N
MW275.22 g/mol
LogP1.70
Rot. Bonds5

About 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid

5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 18548731) has the molecular formula C13H9NO6 and a molecular weight of 275.22 g/mol. Its IUPAC name is 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid
PubChem CID18548731
Molecular FormulaC13H9NO6
Molecular Weight275.22 g/mol
Exact Mass275.04
IUPAC Name5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)CC(=O)c1cccc(-c2ocnc2C(=O)O)c1
InChIInChI=1S/C13H9NO6/c15-9(5-10(16)17)7-2-1-3-8(4-7)12-11(13(18)19)14-6-20-12/h1-4,6H,5H2,(H,16,17)(H,18,19)
InChIKeyDYIXTNBDZKXEKA-UHFFFAOYSA-N
XLogP1.70
TPSA117.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.22
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid (CID 18548731) is 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid is O=C(O)CC(=O)c1cccc(-c2ocnc2C(=O)O)c1.
What is the InChIKey of 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid?
The InChIKey is DYIXTNBDZKXEKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO6/c15-9(5-10(16)17)7-2-1-3-8(4-7)12-11(13(18)19)14-6-20-12/h1-4,6H,5H2,(H,16,17)(H,18,19).
What are the key properties of 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid?
5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid has a molecular weight of 275.22 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 18548731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).