C13H9NO6 — CID 18548731
5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 18548731) has the molecular formula C13H9NO6 and a molecular weight of 275.22 g/mol. Its IUPAC name is 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18548731 |
| Molecular Formula | C13H9NO6 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 5-[3-(2-carboxyacetyl)phenyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)CC(=O)c1cccc(-c2ocnc2C(=O)O)c1 |
| InChI | InChI=1S/C13H9NO6/c15-9(5-10(16)17)7-2-1-3-8(4-7)12-11(13(18)19)14-6-20-12/h1-4,6H,5H2,(H,16,17)(H,18,19) |
| InChIKey | DYIXTNBDZKXEKA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|