C10H6NO3- — CID 6932039
5-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 6932039) has the molecular formula C10H6NO3- and a molecular weight of 188.16 g/mol. Its IUPAC name is 5-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | 5-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 6932039 |
| Molecular Formula | C10H6NO3- |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 5-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | O=C([O-])c1ncoc1-c1ccccc1 |
| InChI | InChI=1S/C10H7NO3/c12-10(13)8-9(14-6-11-8)7-4-2-1-3-5-7/h1-6H,(H,12,13)/p-1 |
| InChIKey | RUKDIKJSGDVSIF-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |