C25H24N6O3S — CID 18549356
2-[(3-carbamimidoylphenyl)methyl]-5-methyl-N-[2-(2-sulfamoylphenyl)phenyl]pyrazole-3-carboxamide (PubChem CID 18549356) has the molecular formula C25H24N6O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-[(3-carbamimidoylphenyl)methyl]-5-methyl-N-[2-(2-sulfamoylphenyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 2-[(3-carbamimidoylphenyl)methyl]-5-methyl-N-[2-(2-sulfamoylphenyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 18549356 |
| Molecular Formula | C25H24N6O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[(3-carbamimidoylphenyl)methyl]-5-methyl-N-[2-(2-sulfamoylphenyl)phenyl]pyrazole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(Cn2nc(C)cc2C(=O)Nc2ccccc2-c2ccccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C25H24N6O3S/c1-16-13-22(31(30-16)15-17-7-6-8-18(14-17)24(26)27)25(32)29-21-11-4-2-9-19(21)20-10-3-5-12-23(20)35(28,33)34/h2-14H,15H2,1H3,(H3,26,27)(H,29,32)(H2,28,33,34) |
| InChIKey | RQJKXKPXVQJXEY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|