C18H15Cl2N2O3S- — CID 18555815
(1S,2S,3R,4S)-3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 18555815) has the molecular formula C18H15Cl2N2O3S- and a molecular weight of 410.30 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1S,2S,3R,4S)-3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 18555815 |
| Molecular Formula | C18H15Cl2N2O3S- |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | (1S,2S,3R,4S)-3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1)[C@@H]1[C@H]2CC[C@@H](C2)[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C18H16Cl2N2O3S/c19-11-4-3-8(6-12(11)20)13-7-26-18(21-13)22-16(23)14-9-1-2-10(5-9)15(14)17(24)25/h3-4,6-7,9-10,14-15H,1-2,5H2,(H,24,25)(H,21,22,23)/p-1/t9-,10-,14+,15-/m0/s1 |
| InChIKey | QWAQYPGQLGNARW-MISXLKTNSA-M |
| XLogP | 3.47 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |