C13H9ClN2O5S — CID 18558914
(NE)-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 18558914) has the molecular formula C13H9ClN2O5S and a molecular weight of 340.74 g/mol. Its IUPAC name is (NE)-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | (NE)-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18558914 |
| Molecular Formula | C13H9ClN2O5S |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | (NE)-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2\C=CC(=O)C(Cl)=C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9ClN2O5S/c1-8-2-4-10(7-12(8)16(18)19)22(20,21)15-9-3-5-13(17)11(14)6-9/h2-7H,1H3/b15-9+ |
| InChIKey | MQMNCTUEVCCILX-OQLLNIDSSA-N |
| XLogP | 2.29 |
| TPSA | 106.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|