C15H12ClFN6O — CID 18566031
1-(2-chlorophenyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea (PubChem CID 18566031) has the molecular formula C15H12ClFN6O and a molecular weight of 346.75 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 18566031 |
| Molecular Formula | C15H12ClFN6O |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea |
| SMILES | O=C(NCc1nnnn1-c1cccc(F)c1)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H12ClFN6O/c16-12-6-1-2-7-13(12)19-15(24)18-9-14-20-21-22-23(14)11-5-3-4-10(17)8-11/h1-8H,9H2,(H2,18,19,24) |
| InChIKey | YDTYSKAIVYXJFQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |