C11H12ClFN6O — CID 18566025
1-(2-chloroethyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea (PubChem CID 18566025) has the molecular formula C11H12ClFN6O and a molecular weight of 298.71 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 18566025 |
| Molecular Formula | C11H12ClFN6O |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(2-chloroethyl)-3-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]urea |
| SMILES | O=C(NCCCl)NCc1nnnn1-c1cccc(F)c1 |
| InChI | InChI=1S/C11H12ClFN6O/c12-4-5-14-11(20)15-7-10-16-17-18-19(10)9-3-1-2-8(13)6-9/h1-3,6H,4-5,7H2,(H2,14,15,20) |
| InChIKey | ZFZMEOQXAIOESQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|