C27H30N4O6 — CID 18566990
N-(1,3-benzodioxol-5-yl)-2-[5-methoxy-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-1-pyridinyl]acetamide (PubChem CID 18566990) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[5-methoxy-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-1-pyridinyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[5-methoxy-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 18566990 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[5-methoxy-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-1-pyridinyl]acetamide |
| SMILES | COc1ccc(N2CCN(Cc3cc(=O)c(OC)cn3CC(=O)Nc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C27H30N4O6/c1-34-22-6-4-20(5-7-22)30-11-9-29(10-12-30)15-21-14-23(32)26(35-2)16-31(21)17-27(33)28-19-3-8-24-25(13-19)37-18-36-24/h3-8,13-14,16H,9-12,15,17-18H2,1-2H3,(H,28,33) |
| InChIKey | LQORKOLNWPWHMU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|