C25H26FN5O5 — CID 27451939
2-[2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-methoxy-4-oxo-1-pyridinyl]-N-(3-nitrophenyl)acetamide (PubChem CID 27451939) has the molecular formula C25H26FN5O5 and a molecular weight of 495.51 g/mol. Its IUPAC name is 2-[2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-methoxy-4-oxo-1-pyridinyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-methoxy-4-oxo-1-pyridinyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 27451939 |
| Molecular Formula | C25H26FN5O5 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 2-[2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-methoxy-4-oxo-1-pyridinyl]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1cn(CC(=O)Nc2cccc([N+](=O)[O-])c2)c(CN2CCN(c3ccc(F)cc3)CC2)cc1=O |
| InChI | InChI=1S/C25H26FN5O5/c1-36-24-16-30(17-25(33)27-19-3-2-4-21(13-19)31(34)35)22(14-23(24)32)15-28-9-11-29(12-10-28)20-7-5-18(26)6-8-20/h2-8,13-14,16H,9-12,15,17H2,1H3,(H,27,33) |
| InChIKey | AHJLHCZPAGIBJG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|